Biorobin
Modify Date: 2025-08-26 14:07:03
Biorobin structure
|
Common Name | Biorobin | ||
|---|---|---|---|---|
| CAS Number | 17297-56-2 | Molecular Weight | 594.518 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 941.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C27H30O15 | Melting Point | 221-223℃ | |
| MSDS | N/A | Flash Point | 312.8±27.8 °C | |
Use of BiorobinBiorobin (Kaempferol 3-O-robinobioside), a flavonoid, significantly inhibits the human lymphocyte proliferation in vitro[1]. |
| Name | 4-Acetamidophenyl phenyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Description | Biorobin (Kaempferol 3-O-robinobioside), a flavonoid, significantly inhibits the human lymphocyte proliferation in vitro[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Biorobin (Kaempferol 3-O-robinobioside) inhibits the in vitro proliferative response of human T-cells (IC50=25 mg/mL)[1]. |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 941.7±65.0 °C at 760 mmHg |
| Melting Point | 221-223℃ |
| Molecular Formula | C27H30O15 |
| Molecular Weight | 594.518 |
| Flash Point | 312.8±27.8 °C |
| Exact Mass | 594.158447 |
| PSA | 249.20000 |
| LogP | 1.96 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.744 |
| InChIKey | RTATXGUCZHCSNG-KYGWAIEOSA-N |
| SMILES | CC1OC(OCC2OC(Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)C(O)C(O)C2O)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|
| Kaempferol-3-O-α-L-rhamnopyranosyl-(1-->6)-β-D-galactopyranoside |
| Nicotiflorin |
| Nicotiflorine |
| Kaempferol 3-O-rutinose |
| 4H-1-Benzopyran-4-one, 3-[[6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-galactopyranosyl]oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)- |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-galactopyranoside |
| Kaempferol-3-O-rutinoside |
| NICOTIFLOROSIDE |
| Kaempferol 3-Rutinoside |