2-(1-Hydroxy-3-Methylbutylidene)-5,5-Dimethyl-1,3-Cyclohexanedione structure
|
Common Name | 2-(1-Hydroxy-3-Methylbutylidene)-5,5-Dimethyl-1,3-Cyclohexanedione | ||
|---|---|---|---|---|
| CAS Number | 172611-72-2 | Molecular Weight | 224.296 | |
| Density | 1.065g/cm3 | Boiling Point | 330.227°C at 760 mmHg | |
| Molecular Formula | C13H20O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 167.724°C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5,5-Dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 330.227°C at 760 mmHg |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.296 |
| Flash Point | 167.724°C |
| Exact Mass | 224.141251 |
| PSA | 51.21000 |
| LogP | 1.68 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | HNPWTDUZIXAJSA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1C(=O)CC(C)(C)CC1=O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914299000 |
| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
S.R. Chhabra et al.
Tetrahedron Lett. 39 , 1603, (1998)
|
| 1,3-Cyclohexanedione, 5,5-dimethyl-2-(3-methyl-1-oxobutyl)- |
| 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione |
| 5,5-Dimethyl-2-(3-methylbutanoyl)-1,3-cyclohexanedione |
| 2-(1-Hydroxy-3-Methylbutylidene)-5,5-Dimethyl-1,3-Cyclohexanedione |
| DMAB-OH |