3-((tert-Butoxycarbonyl)(methoxy)amino)propanoic acid structure
|
Common Name | 3-((tert-Butoxycarbonyl)(methoxy)amino)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 172299-81-9 | Molecular Weight | 219.235 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 327.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.0±23.2 °C | |
| Name | 3-((tert-Butoxycarbonyl)(methoxy)amino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 327.8±25.0 °C at 760 mmHg |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.235 |
| Flash Point | 152.0±23.2 °C |
| Exact Mass | 219.110672 |
| PSA | 76.07000 |
| LogP | 1.17 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.468 |
| InChIKey | UIRKPSPBQPPPFX-UHFFFAOYSA-N |
| SMILES | CON(CCC(=O)O)C(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[methoxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| β-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-N-methoxy- |
| N-Methoxy-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-β-alanine |