(-)-Phenylephrine hydrogentartrate
Modify Date: 2025-08-22 03:15:11
(-)-Phenylephrine hydrogentartrate structure
|
Common Name | (-)-Phenylephrine hydrogentartrate | ||
|---|---|---|---|---|
| CAS Number | 17162-39-9 | Molecular Weight | 317.292 | |
| Density | N/A | Boiling Point | 341.1ºC at 760 mmHg | |
| Molecular Formula | C13H19NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.4ºC | |
| Name | (R)-3-(1-Hydroxy-2-(methylamino)ethyl)phenol 2,3-dihydroxysuccinate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 341.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H19NO8 |
| Molecular Weight | 317.292 |
| Flash Point | 163.4ºC |
| Exact Mass | 317.111053 |
| PSA | 167.55000 |
| Vapour Pressure | 3.18E-05mmHg at 25°C |
| InChIKey | NHKOTKKHHYKARN-FVGYRXGTSA-N |
| SMILES | CNCC(O)c1cccc(O)c1.O=C(O)C(O)C(O)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butanedioic acid, 2,3-dihydroxy-, (2R,3R)-, compd. with (αR)-3-hydroxy-α-[(methylamino)methyl]benzenemethanol (1:1) |
| Benzenemethanol, 3-hydroxy-α-[(methylamino)methyl]-, (αR)-, 2,3-dihydroxybutanedioate (1:1) (salt) |
| 3-[(1R)-1-Hydroxy-2-(methylamino)ethyl]phenol 2,3-dihydroxysuccinate (1:1) |
| MFCD00060166 |
| 2,3-dihydroxybutanedioic acid,3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol |
| EINECS 241-219-3 |
| (2R,3R)-2,3-Dihydroxysuccinic acid - 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol (1:1) |