Phenylephrine Glucuronide
Modify Date: 2025-10-10 17:39:21
Phenylephrine Glucuronide structure
|
Common Name | Phenylephrine Glucuronide | ||
|---|---|---|---|---|
| CAS Number | 2021255-73-0 | Molecular Weight | 343.329 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 666.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 356.6±31.5 °C | |
Use of Phenylephrine GlucuronidePhenylephrine glucuronide is a metabolite of the α1A-adrenergic receptor agonist phenylephrine. |
| Name | Phenylephrine Glucuronide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 666.0±55.0 °C at 760 mmHg |
| Molecular Formula | C15H21NO8 |
| Molecular Weight | 343.329 |
| Flash Point | 356.6±31.5 °C |
| Exact Mass | 343.126709 |
| LogP | -2.34 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | DMVJUYDQYGHJIC-QBOXMOKDSA-N |
| SMILES | CNCC(O)c1cccc(OC2OC(C(=O)O)C(O)C(O)C2O)c1 |
| β-D-Glucopyranosiduronic acid, 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenyl |
| 3-[(1R)-1-Hydroxy-2-(methylamino)ethyl]phenyl β-D-glucopyranosiduronic acid |
| Phenylephrine Glucuronide |