Tetrazine-biotin
Modify Date: 2025-09-18 17:28:17
Tetrazine-biotin structure
|
Common Name | Tetrazine-biotin | ||
|---|---|---|---|---|
| CAS Number | 1714123-51-9 | Molecular Weight | 413.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23N7O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tetrazine-biotinTetrazine-biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Tetrazine-biotin |
|---|
| Description | Tetrazine-biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C19H23N7O2S |
|---|---|
| Molecular Weight | 413.50 |
| InChIKey | GBJXXSUDJUYIIH-ZOBUZTSGSA-N |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCc1ccc(-c2nncnn2)cc1 |