N-benzyl-L-serine methyl ester hydrochloride
Modify Date: 2025-08-22 11:55:29
N-benzyl-L-serine methyl ester hydrochloride structure
|
Common Name | N-benzyl-L-serine methyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 17136-44-6 | Molecular Weight | 245.70300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-L-serine methyl ester hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16ClNO3 |
|---|---|
| Molecular Weight | 245.70300 |
| Exact Mass | 245.08200 |
| PSA | 58.56000 |
| LogP | 1.50300 |
| InChIKey | MLZCSXDRWLPOTF-HNCPQSOCSA-N |
| SMILES | COC(=O)C(CO)NCc1ccccc1.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzylserine methyl ester hydrochloride |
| N-Benzyl-L-serin-methylester-hydrochlorid |
| N-Benzyl-L-serine methyl ester hydrochloride |