Bzl-L-Phe-OMe * HCl
Modify Date: 2025-08-29 13:55:53
Bzl-L-Phe-OMe * HCl structure
|
Common Name | Bzl-L-Phe-OMe * HCl | ||
|---|---|---|---|---|
| CAS Number | 7703-09-5 | Molecular Weight | 305.79900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bzl-phe-ome hcl |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20ClNO2 |
|---|---|
| Molecular Weight | 305.79900 |
| Exact Mass | 305.11800 |
| PSA | 38.33000 |
| LogP | 3.75340 |
| InChIKey | FKTZZMDPUTVSOH-NTISSMGPSA-N |
| SMILES | COC(=O)C(Cc1ccccc1)NCc1ccccc1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| benzyl-l-phenylalanine methyl ester hydrochloride |
| n-benzyl-l-phenylalanine methyl ester hydrochloride |
| bzl-l-phe-ome hcl |