5-acetyl-2,4-dimethyl-1h-pyrrole-3-carboxylic acid
Modify Date: 2025-08-25 14:13:53
5-acetyl-2,4-dimethyl-1h-pyrrole-3-carboxylic acid structure
|
Common Name | 5-acetyl-2,4-dimethyl-1h-pyrrole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 17106-15-9 | Molecular Weight | 181.18900 | |
| Density | 1.255g/cm3 | Boiling Point | 392.7ºC at 760 mmHg | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.3ºC | |
| Name | 5-acetyl-2,4-dimethyl-1h-pyrrole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 392.7ºC at 760 mmHg |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.18900 |
| Flash Point | 191.3ºC |
| Exact Mass | 181.07400 |
| PSA | 70.16000 |
| LogP | 1.53230 |
| Vapour Pressure | 7.18E-07mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | ZGJJSECHXQTROG-UHFFFAOYSA-N |
| SMILES | CC(=O)c1[nH]c(C)c(C(=O)O)c1C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-acetyl-2,4-dimethylpyrrole-3-carboxylic acid |
| 5-Acetyl-2,4-dimethyl-pyrrol-3-carbonsaeure |