Aureusimine B
Modify Date: 2025-12-01 16:52:35
Aureusimine B structure
|
Common Name | Aureusimine B | ||
|---|---|---|---|---|
| CAS Number | 170713-71-0 | Molecular Weight | 228.29 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Aureusimine BAureusimine B (Phevalin) is a cyclic dipeptide. Aureusimine B can be produced by Staphylococcus aureus biofilms. Aureusimine B may be exploited as potential biomarker and/or therapeutic target for chronic, S. aureus biofilm-based infections[1]. |
| Name | 6-benzyl-3-(propan-2-yl)pyrazin-2-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Aureusimine B (Phevalin) is a cyclic dipeptide. Aureusimine B can be produced by Staphylococcus aureus biofilms. Aureusimine B may be exploited as potential biomarker and/or therapeutic target for chronic, S. aureus biofilm-based infections[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 |
| Exact Mass | 228.126266 |
| LogP | 2.42 |
| Index of Refraction | 1.580 |
| InChIKey | CZUORGWXUVRUMV-UHFFFAOYSA-N |
| SMILES | CC(C)c1ncc(Cc2ccccc2)[nH]c1=O |
| 6-Benzyl-3-isopropyl-2(1H)-pyrazinone |
| 2(1H)-Pyrazinone, 3-(1-methylethyl)-6-(phenylmethyl)- |
| MFCD00930483 |
| 6-benzyl-3-(propan-2-yl)pyrazin-2-ol |