Decylmagnesium bromide structure
|
Common Name | Decylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 17049-50-2 | Molecular Weight | 245.48300 | |
| Density | 0.846 g/mL at 25ºC | Boiling Point | N/A | |
| Molecular Formula | C10H21BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -40 °F | |
| Name | Decylmagnesium bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.846 g/mL at 25ºC |
|---|---|
| Molecular Formula | C10H21BrMg |
| Molecular Weight | 245.48300 |
| Flash Point | -40 °F |
| Exact Mass | 244.06800 |
| LogP | 4.94030 |
| InChIKey | CWTPEXDGZPTZSH-UHFFFAOYSA-M |
| SMILES | [Br-].[CH2-]CCCCCCCCC.[Mg+2] |
| Hazard Codes | F+,C |
|---|---|
| Risk Phrases | R12 |
| Safety Phrases | S16-S26-S28-S45-S36-S37-S39 |
| RIDADR | UN 2924 3/PG 1 |
| HS Code | 2931900090 |
|
~%
Decylmagnesium ... CAS#:17049-50-2 |
| Literature: Tetrahedron Letters, , vol. 25, # 42 p. 4805 - 4808 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD00013516 |
| magnesium,decane,bromide |