Bz-Lys-OMe structure
|
Common Name | Bz-Lys-OMe | ||
|---|---|---|---|---|
| CAS Number | 17039-40-6 | Molecular Weight | 264.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bz-Lys-OMeBz-Lys-Ome is a specific methyl ester substrate of trypsin[1]. |
| Name | Bz-Lys-OMe |
|---|
| Description | Bz-Lys-Ome is a specific methyl ester substrate of trypsin[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H20N2O3 |
|---|---|
| Molecular Weight | 264.32 |
| InChIKey | RNFLYGMDYGDLQG-LBPRGKRZSA-N |
| SMILES | COC(=O)C(CCCCN)NC(=O)c1ccccc1 |