3-(5-METHYL-FURAN-2-YL)-PROPIONALDEHYDE structure
|
Common Name | 3-(5-METHYL-FURAN-2-YL)-PROPIONALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 16948-04-2 | Molecular Weight | 561.75300 | |
| Density | N/A | Boiling Point | 587ºC at 760 mmHg | |
| Molecular Formula | C31H51N3O6 | Melting Point | 114-116ºC | |
| MSDS | USA | Flash Point | 308.8ºC | |
Use of 3-(5-METHYL-FURAN-2-YL)-PROPIONALDEHYDEBoc-Lys(Z)-OH (DCHA) is a involves in synthesis thymosin β4, βg and β6 fragments, and increases E-rosette forming capacity in Lupus Nephritis model. Boc-Lys(Z)-OH (DCHA) involves in synthesis Boc-Lyz-OCH3 and acts as a reagent of peptidyl thrombin inhibitors production[1][2][3]. |
| Name | boc-lys(z)-oh dcha |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Lys(Z)-OH (DCHA) is a involves in synthesis thymosin β4, βg and β6 fragments, and increases E-rosette forming capacity in Lupus Nephritis model. Boc-Lys(Z)-OH (DCHA) involves in synthesis Boc-Lyz-OCH3 and acts as a reagent of peptidyl thrombin inhibitors production[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 587ºC at 760 mmHg |
|---|---|
| Melting Point | 114-116ºC |
| Molecular Formula | C31H51N3O6 |
| Molecular Weight | 561.75300 |
| Flash Point | 308.8ºC |
| Exact Mass | 561.37800 |
| PSA | 125.99000 |
| LogP | 7.47510 |
| Vapour Pressure | 1.26E-14mmHg at 25°C |
| InChIKey | BQERJWRZLXZNIO-RSAXXLAASA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NC(CCCCNC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | -20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29224985 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| N-cyclohexylcyclohexanamine,(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| MFCD00066511 |
| Nalpha-BOC-Nepsilon-CBZ-L-Lysine DCHA |
| EINECS 241-018-0 |