L-Valine,N-(2,4-dinitrophenyl)- structure
|
Common Name | L-Valine,N-(2,4-dinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1694-97-9 | Molecular Weight | 283.23700 | |
| Density | 1.46g/cm3 | Boiling Point | 504.1ºC at 760mmHg | |
| Molecular Formula | C11H13N3O6 | Melting Point | 131 °C | |
| MSDS | N/A | Flash Point | 258.7ºC | |
Use of L-Valine,N-(2,4-dinitrophenyl)-N-(2,4-Dinitrophenyl)-L-valine is a valine derivative[1]. |
| Name | n-(2,4-dinitrophenyl)-l-valine |
|---|---|
| Synonym | More Synonyms |
| Description | N-(2,4-Dinitrophenyl)-L-valine is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 504.1ºC at 760mmHg |
| Melting Point | 131 °C |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.23700 |
| Flash Point | 258.7ºC |
| Exact Mass | 283.08000 |
| PSA | 140.97000 |
| LogP | 3.14350 |
| Vapour Pressure | 5.54E-11mmHg at 25°C |
| Index of Refraction | -26 ° (C=1, AcOH) |
| InChIKey | AYLCDVYHZOZQKM-JTQLQIEISA-N |
| SMILES | CC(C)C(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2922499990 |
|
~94%
L-Valine,N-(2,4... CAS#:1694-97-9 |
| Literature: Tetrahedron, , vol. 56, # 42 p. 8287 - 8289 |
|
~56%
L-Valine,N-(2,4... CAS#:1694-97-9 |
| Literature: Tetrahedron, , vol. 56, # 42 p. 8287 - 8289 |
|
~53%
L-Valine,N-(2,4... CAS#:1694-97-9 |
| Literature: Tetrahedron, , vol. 56, # 42 p. 8287 - 8289 |
|
~%
L-Valine,N-(2,4... CAS#:1694-97-9 |
| Literature: Analytical Chemistry, , vol. 68, # 7 p. 1191 - 1196 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD00038096 |
| N-(2,4-Dinitrophenyl)-L-valine |
| N-Dnp-L-valine |
| DNP-L-valine |
| EINECS 216-909-2 |
| 2-(2,4-dinitroanilino)-3-methylbutanoic acid |