OSM-SMI-8
Modify Date: 2025-08-27 13:24:32
OSM-SMI-8 structure
|
Common Name | OSM-SMI-8 | ||
|---|---|---|---|---|
| CAS Number | 1689690-20-7 | Molecular Weight | 512.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H20N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of OSM-SMI-8OSM-SMI-8 (NSC642624) is a potent OSM (oncostatin M) antagonist. OSM-SMI-8 has the potential for the research of cancer[1]. |
| Name | OSM-SMI-8 |
|---|
| Description | OSM-SMI-8 (NSC642624) is a potent OSM (oncostatin M) antagonist. OSM-SMI-8 has the potential for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H20N2O4S2 |
|---|---|
| Molecular Weight | 512.60 |
| InChIKey | UJBUSAZATHWVAW-AEPXBALGSA-N |
| SMILES | O=C(O)C(=CC=Cc1ccccc1)c1csc(-c2nc(C(=CC=Cc3ccccc3)C(=O)O)cs2)n1 |