Cycleanine plus mixture of other alkaloids
Modify Date: 2025-09-21 19:25:49
Cycleanine plus mixture of other alkaloids structure
|
Common Name | Cycleanine plus mixture of other alkaloids | ||
|---|---|---|---|---|
| CAS Number | 16846-79-0 | Molecular Weight | 622.75000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H42N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Cycleanine plus mixture of other alkaloids |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C38H42N2O6 |
|---|---|
| Molecular Weight | 622.75000 |
| Exact Mass | 622.30400 |
| PSA | 61.86000 |
| LogP | 7.03820 |
| InChIKey | ANOXEUSGZWSCQL-UHFFFAOYSA-N |
| SMILES | COc1cc2c3c(c1OC)Oc1ccc(cc1)CC1c4c(cc(OC)c(OC)c4Oc4ccc(cc4)CC3N(C)CC2)CCN1C |
| hms3327a22 |