Methyl 4-amino-3-(trifluoromethyl)benzoate structure
|
Common Name | Methyl 4-amino-3-(trifluoromethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 167760-75-0 | Molecular Weight | 219.161 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 305.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.7±27.9 °C | |
| Name | Methyl 4-amino-3-(trifluoromethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 305.7±42.0 °C at 760 mmHg |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.161 |
| Flash Point | 138.7±27.9 °C |
| Exact Mass | 219.050720 |
| PSA | 52.32000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | CLKBQIFUKHNMQY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N)c(C(F)(F)F)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 4-amino-3-(trifluoromethyl)-, methyl ester |
| Methyl 4-amino-3-(trifluoromethyl)benzoate |
| 4-amino-3-trifluoromethyl-benzoic acid methyl ester |