3(2H)-Pyridazinone,6-[(phenylsulfonyl)oxy]- structure
|
Common Name | 3(2H)-Pyridazinone,6-[(phenylsulfonyl)oxy]- | ||
|---|---|---|---|---|
| CAS Number | 16771-17-8 | Molecular Weight | 252.24700 | |
| Density | 1.48g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (6-oxo-1H-pyridazin-3-yl) benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.24700 |
| Exact Mass | 252.02000 |
| PSA | 97.50000 |
| LogP | 1.61840 |
| Index of Refraction | 1.644 |
| InChIKey | AIPDCPMXCWRNRS-UHFFFAOYSA-N |
| SMILES | O=c1ccc(OS(=O)(=O)c2ccccc2)n[nH]1 |
|
~%
3(2H)-Pyridazin... CAS#:16771-17-8 |
| Literature: Szabo; Oswald Acta Chimica Academiae Scientiarum Hungaricae, 1958 , vol. 15, p. 1,4 Full Text Show Details Feuer; Rubinstein Journal of the American Chemical Society, 1958 , vol. 80, p. 5873,5876 |
|
~%
3(2H)-Pyridazin... CAS#:16771-17-8 |
| Literature: Feuer; Rubinstein Journal of Organic Chemistry, 1959 , vol. 24, p. 811 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-benzenesulfonyloxy-2H-pyridazin-3-one |
| O-Benzol-sulfonyl-maleinsaeurehydrazid |
| 6-oxo-1,6-dihydropyridazin-3-yl benzenesulfonate |
| 6-Benzolsulfonyloxy-2H-pyridazin-3-on |
| Benzolsulfonyloxy-6-2H-pyridazinon-3 |