PD-1-IN-1
Modify Date: 2025-09-29 18:58:26
PD-1-IN-1 structure
|
Common Name | PD-1-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1673534-76-3 | Molecular Weight | 360.326 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PD-1-IN-1PD-1-IN-1 is an inhibitor of programmed cell dealth-1 (PD-1) extracted from patent WO 2015033299 A1, compound example 4. |
| Name | PD-1-IN-1 |
|---|
| Description | PD-1-IN-1 is an inhibitor of programmed cell dealth-1 (PD-1) extracted from patent WO 2015033299 A1, compound example 4. |
|---|---|
| Related Catalog | |
| References |
[1]. WO 2015033299 A1 |
| Molecular Formula | C12H20N6O7 |
|---|---|
| Molecular Weight | 360.326 |
| InChIKey | HFOBENSCBRZVSP-LKXGYXEUSA-N |
| SMILES | CC(O)C(NC(=O)NC(CC(N)=O)c1nc(C(N)CO)no1)C(=O)O |