Trioxo(trimethylsilanolato)rhenium
Modify Date: 2025-08-25 16:29:47
Trioxo(trimethylsilanolato)rhenium structure
|
Common Name | Trioxo(trimethylsilanolato)rhenium | ||
|---|---|---|---|---|
| CAS Number | 16687-12-0 | Molecular Weight | 323.394 | |
| Density | N/A | Boiling Point | 65-75ºC 1mm | |
| Molecular Formula | C3H9O4ReSi | Melting Point | 79-81ºC | |
| MSDS | N/A | Flash Point | >65ºC | |
| Name | hydroxy(trimethyl)silane,trioxorhenium |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 65-75ºC 1mm |
|---|---|
| Melting Point | 79-81ºC |
| Molecular Formula | C3H9O4ReSi |
| Molecular Weight | 323.394 |
| Flash Point | >65ºC |
| Exact Mass | 323.982605 |
| PSA | 60.44000 |
| LogP | 0.94580 |
| InChIKey | ISJDDRALPATORK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O.O=[Re](=O)=O |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| trimethylsilylperrhenate |
| Trimethylsilylperrhenat |
| (Me3SiO)ReO3 |
| Me3SiO2SiMe3 |
| Trioxo(trimethylsilanolato)rhenium |
| trimethylsilyl peroxide |
| Bis(trimethylsilyl) Peroxide |
| trimethylsilyloxy rheniumoxide |
| Rhenium, trioxo(1,1,1-trimethylsilanolato)- |
| Silane,1,1'-dioxybis[1,1,1-trimethyl |
| perrhenic acid trimethylsilyl ester |