1,3,5-trimethyl-2-(1-phenylvinyl)-benzene structure
|
Common Name | 1,3,5-trimethyl-2-(1-phenylvinyl)-benzene | ||
|---|---|---|---|---|
| CAS Number | 1667-02-3 | Molecular Weight | 222.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,5-trimethyl-2-(1-phenylvinyl)-benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18 |
|---|---|
| Molecular Weight | 222.32500 |
| Exact Mass | 222.14100 |
| LogP | 4.67330 |
| InChIKey | JWJYFPRVAMZFCB-UHFFFAOYSA-N |
| SMILES | C=C(c1ccccc1)c1c(C)cc(C)cc1C |
|
~%
1,3,5-trimethyl... CAS#:1667-02-3 |
| Literature: Fuson et al. Journal of the American Chemical Society, 1944 , vol. 66, p. 681,683 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1,3,5-trimethyl-2-(1-phenylvinyl)benzene |
| 1-mesitylstyrene |
| 1-mesityl-1-phenylethene |
| 1-phenyl-1-(2,4,6-trimethylphenyl)ethane |
| 1-phenyl-1-(2,4,6-trimethylphenyl)ethene |