Benzeneacetic acid,2,4,6-trimethyl-a-phenyl- structure
|
Common Name | Benzeneacetic acid,2,4,6-trimethyl-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 3901-04-0 | Molecular Weight | 254.32400 | |
| Density | 1.107g/cm3 | Boiling Point | 354.2ºC at 760mmHg | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2ºC | |
| Name | 2-phenyl-2-(2,4,6-trimethylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 354.2ºC at 760mmHg |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.32400 |
| Flash Point | 182.2ºC |
| Exact Mass | 254.13100 |
| PSA | 37.30000 |
| LogP | 3.82830 |
| Index of Refraction | 1.578 |
| InChIKey | RYZVPLVIQGWEIJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(C(=O)O)c2ccccc2)c(C)c1 |
| HS Code | 2916399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Mesitoxyessigsaeure |
| Mesityl-phenyl-essigsaeure |
| Mesityloxy-essigsaeure |
| mesityloxy-acetic acid |
| 2.4.6-Trimethyl-phenoxyessigsaeure |
| mesityl-phenyl-acetic acid |