4-(4-Benzyl-1-piperazinyl)benzaldehyde structure
|
Common Name | 4-(4-Benzyl-1-piperazinyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 166438-88-6 | Molecular Weight | 280.364 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 446.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H20N2O | Melting Point | 73-75ºC | |
| MSDS | N/A | Flash Point | 195.3±21.1 °C | |
| Name | 4-(4-Benzylpiperazino)benzenecarbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 446.3±45.0 °C at 760 mmHg |
| Melting Point | 73-75ºC |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.364 |
| Flash Point | 195.3±21.1 °C |
| Exact Mass | 280.157562 |
| PSA | 23.55000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | JDWZUVQRUPAVPK-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(N2CCN(Cc3ccccc3)CC2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~%
4-(4-Benzyl-1-p... CAS#:166438-88-6 |
| Literature: US2004/67878 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD01765492 |
| 4-(4-Benzylpiperazin-1-yl)benzaldehyde |
| 4-(4-Benzyl-1-piperazinyl)benzaldehyde |
| Benzaldehyde, 4-[4-(phenylmethyl)-1-piperazinyl]- |