Potassium 3,5-bis(trifluoromethyl)phenytrifluoroborate
Potassium 3,5-bis(trifluoromethyl)phenytrifluoroborate structure
|
Common Name | Potassium 3,5-bis(trifluoromethyl)phenytrifluoroborate | ||
|---|---|---|---|---|
| CAS Number | 166328-09-2 | Molecular Weight | 320.00400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3BF9K | Melting Point | >300℃ | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | >300℃ |
|---|---|
| Molecular Formula | C8H3BF9K |
| Molecular Weight | 320.00400 |
| Exact Mass | 319.98200 |
| LogP | 3.77860 |
| InChIKey | WCHMTVMZBOZGCS-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[K+] |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22,S24/25,S36/37/39,S45 |
| WGK Germany | 3 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Potassium 3,5-bis(trifluoromethyl)phenytrifluoroborate |
| PC1769 |
| MFCD03701625 |
| Potassium [3,5-bis(trifluoromethyl)phenyl]trifluoroborate |
| A-3955 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide? |
| A: Melting point of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide is >300℃. |
| Q: What is the InChIKey of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide? |
| A: InChIKey of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide is WCHMTVMZBOZGCS-UHFFFAOYSA-N. |
| Q: What is the LogP of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide? |
| A: LogP of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide is 3.77860. |
| Q: What is the English name of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide? |
| A: The English name of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide is potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide. |
| Q: What is the safety information for potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide? |
| A: Safety information for potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide: S22,S24/25,S36/37/39,S45. |
| Q: What is the molecular weight of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide? |
| A: Molecular weight of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide is 320.00400. |
| Q: What is the molecular formula of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide? |
| A: Molecular formula of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide is C8H3BF9K. |
| Q: What is the SMILES notation of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide? |
| A: SMILES notation of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide is F[B-](F)(F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[K+]. |
| Q: What English synonyms does potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide have? |
| A: English synonyms of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide: Potassium 3,5-bis(trifluoromethyl)phenytrifluoroborate, PC1769, MFCD03701625, Potassium [3,5-bis(trifluoromethyl)phenyl]trifluoroborate, A-3955. |
| Q: What is the CAS number of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide? |
| A: CAS number of potassium,[3,5-bis(trifluoromethyl)phenyl]-trifluoroboranuide is 166328-09-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |