1,1,2,2-Tetrafluoroethyl-2,2,3,3-tetrafluoropropylether structure
|
Common Name | 1,1,2,2-Tetrafluoroethyl-2,2,3,3-tetrafluoropropylether | ||
|---|---|---|---|---|
| CAS Number | 16627-68-2 | Molecular Weight | 232.07200 | |
| Density | 1.533 | Boiling Point | 92 °C | |
| Molecular Formula | C5H4F8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 27.5 °C | |
| Name | 1,1,2,2-Tetrafluoroethyl-2,2,3,3-Tetrafluoropropylether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.533 |
|---|---|
| Boiling Point | 92 °C |
| Molecular Formula | C5H4F8O |
| Molecular Weight | 232.07200 |
| Flash Point | 27.5 °C |
| Exact Mass | 232.01300 |
| PSA | 9.23000 |
| LogP | 2.76130 |
| Index of Refraction | 1.29 |
| InChIKey | HCBRSIIGBBDDCD-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)COC(F)(F)C(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 3271.0 |
| Hazard Class | 3.0 |
| HS Code | 2909199090 |
|
~96%
1,1,2,2-Tetrafl... CAS#:16627-68-2 |
| Literature: Daikin Industries, Ltd. Patent: EP2305626 A1, 2011 ; Location in patent: Page/Page column 6-8; 11 ; |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,1,2,2-Tetrafluoroethyl 2,2,3,3-tetrafluoropropyl ether |
| MFCD00155961 |