4-Chloro-3-nitrobenzaldehyde structure
|
Common Name | 4-Chloro-3-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 16588-34-4 | Molecular Weight | 185.565 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 299.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClNO3 | Melting Point | 61-63 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 135.1±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Chloro-3-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 299.8±25.0 °C at 760 mmHg |
| Melting Point | 61-63 °C(lit.) |
| Molecular Formula | C7H4ClNO3 |
| Molecular Weight | 185.565 |
| Flash Point | 135.1±23.2 °C |
| Exact Mass | 184.987976 |
| PSA | 62.89000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | HETBKLHJEWXWBM-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| Water Solubility | 4 g/L (98 ºC) |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37-S36/37/39-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2913000090 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 4-Chloro-5-nitrobenzaldehyde |
| 4-Chloro-3-nitrobenzaldehyde |
| MFCD00007078 |
| 3-Nitro-4-Chlorobenzaldehyde |
| Benzaldehyde,4-chloro-3-nitro |
| 4-chloro-3-nitro-benzaldehyde |
| EINECS 240-645-7 |
| Benzaldehyde, 4-chloro-3-nitro- |
| 4-Cl-3-NO2-benzaldehyde |
| wnr bg evh |