3-Methoxy-2-nitroaniline structure
|
Common Name | 3-Methoxy-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 16554-47-5 | Molecular Weight | 168.150 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 343.6±22.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.6±22.3 °C | |
| Name | 3-Methoxy-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.6±22.0 °C at 760 mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.150 |
| Flash Point | 161.6±22.3 °C |
| Exact Mass | 168.053497 |
| PSA | 81.07000 |
| LogP | 1.60 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | RITQAMSEQYWFML-UHFFFAOYSA-N |
| SMILES | COc1cccc(N)c1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenamine, 3-methoxy-2-nitro- |
| 3-Methoxy-2-nitroaniline |