dnp-dl-glutamic acid
Modify Date: 2025-08-29 10:59:56
dnp-dl-glutamic acid structure
|
Common Name | dnp-dl-glutamic acid | ||
|---|---|---|---|---|
| CAS Number | 1655-48-7 | Molecular Weight | 313.22000 | |
| Density | 1.664g/cm3 | Boiling Point | 619.9ºC at 760mmHg | |
| Molecular Formula | C11H11N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.7ºC | |
| Name | 2-(2,4-dinitroanilino)pentanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.664g/cm3 |
|---|---|
| Boiling Point | 619.9ºC at 760mmHg |
| Molecular Formula | C11H11N3O8 |
| Molecular Weight | 313.22000 |
| Flash Point | 328.7ºC |
| Exact Mass | 313.05500 |
| PSA | 178.27000 |
| LogP | 2.35230 |
| Vapour Pressure | 3.16E-16mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | NZBKHTRVUNPZEN-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| Storage condition | −20°C |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| HS Code | 2922499990 |
|
~%
dnp-dl-glutamic acid CAS#:1655-48-7 |
| Literature: Wong; Connors Journal of Pharmaceutical Sciences, 1983 , vol. 72, # 2 p. 146 - 150 |
|
~%
dnp-dl-glutamic acid CAS#:1655-48-7 |
| Literature: Blackburn Biochemical Journal, 1949 , vol. 45, p. 579,580 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| n-(2,4-dinitrophenyl)glutamicacid |
| N-(2.4-dinitro-phenyl)-DL-glutamic acid |
| N-(2,4-Dinitro-phenyl)-DL-glutaminsaeure |
| DNP-DL-GLUTAMIC ACID |
| DNP-Glutaminsaeure |
| 2-[(2,4-dinitrophenyl)amino]pentanedioic acid |