ac1l4cq7
Modify Date: 2025-09-24 17:22:40
ac1l4cq7 structure
|
Common Name | ac1l4cq7 | ||
|---|---|---|---|---|
| CAS Number | 16530-40-8 | Molecular Weight | 439.58700 | |
| Density | 1.26g/cm3 | Boiling Point | 569.9ºC at 760 mmHg | |
| Molecular Formula | C27H37NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.5ºC | |
| Name | ac1l4cq7 |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 569.9ºC at 760 mmHg |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.58700 |
| Flash Point | 298.5ºC |
| Exact Mass | 439.27200 |
| PSA | 62.16000 |
| LogP | 3.88170 |
| Vapour Pressure | 7.91E-14mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | YXBKRWBDTSYZIN-FXLCSONSSA-N |
| SMILES | CCCCCC(C)(O)C1CC23C=CC1(OC)C1Oc4c(O)ccc5c4C12CCN(C)C3C5 |
|
~%
ac1l4cq7 CAS#:16530-40-8 |
| Literature: Bentley,K.W.; Hardy,D.G. Journal of the American Chemical Society, 1967 , vol. 89, p. 3281 - 3292 |
