ac1l4ccv structure
|
Common Name | ac1l4ccv | ||
|---|---|---|---|---|
| CAS Number | 16180-32-8 | Molecular Weight | 453.61400 | |
| Density | 1.21g/cm3 | Boiling Point | 564.6ºC at 760mmHg | |
| Molecular Formula | C28H39NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.2ºC | |
| Name | ac1l4ccv |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 564.6ºC at 760mmHg |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.61400 |
| Flash Point | 295.2ºC |
| Exact Mass | 453.28800 |
| PSA | 51.16000 |
| LogP | 4.18470 |
| Vapour Pressure | 1.39E-13mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | NKJUBZPPDRXNOS-CBDDFBHXSA-N |
| SMILES | CCCCCC(C)(O)C1CC23C=CC1(OC)C1Oc4c(OC)ccc5c4C12CCN(C)C3C5 |
|
~%
ac1l4ccv CAS#:16180-32-8 |
| Literature: Bentley; Hardy; Meek Journal of the American Chemical Society, 1967 , vol. 89, # 13 p. 3273 - 3280 |
| (19R)-19-pentyl-thevinol |