calyxin B
Modify Date: 2025-08-25 15:04:10
calyxin B structure
|
Common Name | calyxin B | ||
|---|---|---|---|---|
| CAS Number | 164991-53-1 | Molecular Weight | 582.64 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 864.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C35H34O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.3±27.8 °C | |
Use of calyxin BCalyxin B can be extracted from the seeds of Alpinia blepharocalyx. Calyxin B has anti-proliferative activity and can be used in cancer research[1]. |
| Name | Calyxin B |
|---|---|
| Synonym | More Synonyms |
| Description | Calyxin B can be extracted from the seeds of Alpinia blepharocalyx. Calyxin B has anti-proliferative activity and can be used in cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 864.7±65.0 °C at 760 mmHg |
| Molecular Formula | C35H34O8 |
| Molecular Weight | 582.64 |
| Flash Point | 277.3±27.8 °C |
| Exact Mass | 582.225342 |
| PSA | 147.68000 |
| LogP | 5.65 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | DHYXVFFHVYUZJU-SETFCPTBSA-N |
| SMILES | COc1cc(O)c(C(C=CCC(O)CCc2ccc(O)cc2)c2ccc(O)cc2)c(O)c1C(=O)C=Cc1ccc(O)cc1 |
| Hazard Codes | Xi |
|---|
| calyxin B |
| (2E)-1-{2,4-Dihydroxy-3-[(1S,2E,5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)-2-hepten-1-yl]-6-methoxyphenyl}-3-(4-hydroxyphenyl)-2-propen-1-one |
| 2-Propen-1-one, 1-[2,4-dihydroxy-3-[(1S,2E,5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)-2-hepten-1-yl]-6-methoxyphenyl]-3-(4-hydroxyphenyl)-, (2E)- |