Hemicholinium-3
Modify Date: 2025-10-14 18:49:25
Hemicholinium-3 structure
|
Common Name | Hemicholinium-3 | ||
|---|---|---|---|---|
| CAS Number | 16478-59-4 | Molecular Weight | 414.53800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H34N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Hemicholinium-3Hemicholinium-3 (HC-3) is a competitive, small molecule inhibitor of choline kinase (ChoK) with ex vivo IC50 of 500 uM, also bolcks the sodium and chloride-dependent transport system and affects choline acetyltransferase. |
| Name | 2-[4-[4-(2-hydroxy-4,4-dimethylmorpholin-4-ium-2-yl)phenyl]phenyl]-4,4-dimethylmorpholin-4-ium-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H34N2O4 |
|---|---|
| Molecular Weight | 414.53800 |
| Exact Mass | 414.25200 |
| PSA | 58.92000 |
| LogP | 1.77460 |
| InChIKey | JIWUESGGKYLPPG-UHFFFAOYSA-N |
| SMILES | C[N+]1(C)CCOC(O)(c2ccc(-c3ccc(C4(O)C[N+](C)(C)CCO4)cc3)cc2)C1 |
| 2,2'-(Biphenyl)-4,4'-diylbis(2-hydroxy-4,4-dimethylmorpholinium) |
| 2,2'-biphenyl-4,4'-diylbis(2-hydroxy-4,4-dimethylmorpholin-4-ium) |
| 2,2'-(4,4'-Biphenylene)bis(2-hydroxy-4,4-dimethylmorpholinium) |
| Morpholinium,2,2'-(4,4'-biphenylene)bis(2-hydroxy-4,4-dimethyl |
| Hemicholinium |