Cdk5 Substrate
Modify Date: 2025-08-28 06:24:46
Cdk5 Substrate structure
|
Common Name | Cdk5 Substrate | ||
|---|---|---|---|---|
| CAS Number | 164669-07-2 | Molecular Weight | 1138.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C53H99N15O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cdk5 SubstrateCdk5 Substrate is a biological active peptide. (substrate for the cdc2 protein kinase) |
| Name | pktpkkakkl |
|---|
| Description | Cdk5 Substrate is a biological active peptide. (substrate for the cdc2 protein kinase) |
|---|---|
| Related Catalog |
| Molecular Formula | C53H99N15O12 |
|---|---|
| Molecular Weight | 1138.45 |
| Exact Mass | 1137.76000 |
| PSA | 452.77000 |
| LogP | 3.67960 |
| InChIKey | ZSZMVAFYNVHXHA-BJSZDZKQSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(C)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C1CCCN1C(=O)C(NC(=O)C(CCCCN)NC(=O)C1CCCN1)C(C)O)C(=O)O |