4-fluorobenzylmagnesium chloride
Modify Date: 2025-08-26 18:03:52
4-fluorobenzylmagnesium chloride structure
|
Common Name | 4-fluorobenzylmagnesium chloride | ||
|---|---|---|---|---|
| CAS Number | 1643-73-8 | Molecular Weight | 168.87900 | |
| Density | 0.910g/mLat25ºC(lit.) | Boiling Point | 65ºC(lit.) | |
| Molecular Formula | C7H6ClFMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | 4-fluorobenzylmagnesium chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 0.910g/mLat25ºC(lit.) |
|---|---|
| Boiling Point | 65ºC(lit.) |
| Molecular Formula | C7H6ClFMg |
| Molecular Weight | 168.87900 |
| Flash Point | 1 °F |
| Exact Mass | 167.99900 |
| LogP | 2.83090 |
| InChIKey | JHMNJUQVLPODJN-UHFFFAOYSA-M |
| SMILES | [CH2-]c1ccc(F)cc1.[Cl-].[Mg+2] |
| Storage condition | 2-8°C |
| Water Solubility | Reacts with water. |
| Hazard Codes | F+,C,F |
|---|---|
| Risk Phrases | R12 |
| Safety Phrases | 9-16-29-33-45-36/37/39-26-23 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
|
~%
4-fluorobenzylm... CAS#:1643-73-8 |
| Literature: Journal of Organic Chemistry, , vol. 71, # 23 p. 8975 - 8977 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| magnesium,1-fluoro-4-methanidylbenzene,chloride |
| MFCD01319898 |
| 4-Fluorobenzylmagnesium chloride |