Bis(Tetramethylene)Fluoroformamidinium Hexafluorophosphate structure
|
Common Name | Bis(Tetramethylene)Fluoroformamidinium Hexafluorophosphate | ||
|---|---|---|---|---|
| CAS Number | 164298-25-3 | Molecular Weight | 316.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16F7N2P | Melting Point | 152-157ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Bis(Tetramethylene)Fluoroformamidinium Hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 152-157ºC |
|---|---|
| Molecular Formula | C9H16F7N2P |
| Molecular Weight | 316.19900 |
| Exact Mass | 316.09400 |
| PSA | 19.84000 |
| LogP | 4.49310 |
| Appearance of Characters | Powder or Crystalline Powder | White to off-white |
| InChIKey | MNJUGQKOHJQOCK-UHFFFAOYSA-N |
| SMILES | FC(N1CCCC1)=[N+]1CCCC1.F[P-](F)(F)(F)(F)F |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 29339900 |
|
L.A. Carpino, A. El-Faham
J. Am. Chem. Soc. 117 , 5401, (1995)
|
|
|
A. El-Faham
Chem. Lett. , 671, (1998)
|
| 1-[fluoro(pyrrolidin-1-ium-1-ylidene)methyl]pyrrolidine,hexafluorophosphate |
| Fluoro-N,N,N’,N’-bis(tetramethylene)formamidinium hexafluorophosphate |
| 1-(Fluoro-1-pyrrolidinylmethylene)pyrrolidinium Hexafluorophosphate |
| Fluoro-N,N,N',N'-bis(tetramethylene)formamidinium Hexafluorophosphate |
| Fluoro-dipyrrolidinocarbenium hexafluorophosphate |
| MFCD02683430 |