isoxadifen-ethyl
Modify Date: 2025-08-24 20:00:25
isoxadifen-ethyl structure
|
Common Name | isoxadifen-ethyl | ||
|---|---|---|---|---|
| CAS Number | 163520-33-0 | Molecular Weight | 295.332 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 407.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H17NO3 | Melting Point | 87-88℃ (ethyl ether ) | |
| MSDS | Chinese USA | Flash Point | 166.8±25.9 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of isoxadifen-ethylIsoxadifen-ethyl is an Herbicide Safener. |
| Name | isoxadifen-ethyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.7±55.0 °C at 760 mmHg |
| Melting Point | 87-88℃ (ethyl ether ) |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.332 |
| Flash Point | 166.8±25.9 °C |
| Exact Mass | 295.120850 |
| PSA | 47.89000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | MWKVXOJATACCCH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(c2ccccc2)(c2ccccc2)C1 |
| Storage condition | 0-6°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H410 |
| Precautionary Statements | P273-P280-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn,N |
| Risk Phrases | R22 |
| Safety Phrases | S36/37 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | NY2390000 |
| Packaging Group | III |
| HS Code | 2934999050 |
|
~74%
isoxadifen-ethyl CAS#:163520-33-0 |
| Literature: Cremonesi, Giuseppe; Croce, Piero Dalla; Fontana, Francesco; Fiorelli, Claudio; Rosa, Concetta La Tetrahedron Asymmetry, 2008 , vol. 19, # 24 p. 2850 - 2855 |
|
~%
isoxadifen-ethyl CAS#:163520-33-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 11, # 15 p. 1997 - 2000 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999050 |
|---|---|
| Summary | 2934999050 ethyl 5,5-diphenyl-4,5-dihydroisoxazole-3-carboxylate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
| 5,5-diphenyl-4,5-dihydroisoxazole-3-carboxylic acid ethyl ester |
| isoxadifen-ethyl |
| 3-Isoxazolecarboxylic acid, 4,5-dihydro-5,5-diphenyl-, ethyl ester |
| 4,5-dihydro-5,5-diphenyl-3-isoxazol-carboxylic acid ethyl ester |
| Ethyl 5,5-diphenyl-4,5-dihydroisoxazole-3-carboxylate |
| Ethyl 5,5-diphenyl-2-isoxazoline-3-carboxylate |
| 4,5-Dihydro-5,5-diphenyl-1,2-oxazole-3-carboxylic acid, ethyl ester |
| 4,5-Dihydro-5,5-diphenyl-3-isoxazolecarboxylic acid ethyl ester |
| ethyl 4,5-dihydro-5,5-diphenyl-3-isoxazole-carboxylate |
| Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate |
| ethyl 4,5-dihydro-5,5-diphenyl-1,2-oxazole-3-carboxylate |
| 4,5-dihydro-5,5-diphenyl-1,2-oxazole-3-carboxylic acid ethyl ester |
| ethyl 5,5-diphenyl-4H-1,2-oxazole-3-carboxylate |
| ethyl 5,5-diphenyl-3-isoxazolinecarboxylate |
| Ethyl 4,5-dihydro-5,5-diphenyl-3-isoxazolecarboxylate |
| T5NO EUTJ CR& CR& EVO2 |