Sirpefenicol structure
|
Common Name | Sirpefenicol | ||
|---|---|---|---|---|
| CAS Number | 1632310-24-7 | Molecular Weight | 401.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18F3N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SirpefenicolSirpefenicol is a phenicol antibacterial agent. Sirpefenicol can be used in bacterial infections in animals (extracted from patent WO2020068607A1)[1]. |
| Name | Sirpefenicol |
|---|
| Description | Sirpefenicol is a phenicol antibacterial agent. Sirpefenicol can be used in bacterial infections in animals (extracted from patent WO2020068607A1)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H18F3N3O3S |
|---|---|
| Molecular Weight | 401.40 |
| InChIKey | BCSOJZOJNNYSQM-GDVFORLASA-N |
| SMILES | CS(=N)(=O)c1ccc(-c2ccc(C(O)C(CF)NC(=O)C(F)F)cc2)cn1 |