NSC756093
Modify Date: 2025-09-25 07:14:03
NSC756093 structure
|
Common Name | NSC756093 | ||
|---|---|---|---|---|
| CAS Number | 1629908-92-4 | Molecular Weight | 337.37 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 561.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H19NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 293.6±30.1 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of NSC756093NSC756093 is a potent inhibitor of the GBP1:PIM1 interaction. NSC756093 can potentially revert resistance to paclitaxel. NSC756093 can be used for ovarian cancer research[1]. |
| Name | 4-(2-Hydroxyethyl)-6-methoxy-9-phenyl-4,9-dihydrofuro[3,4-b]quinolin-1(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Description | NSC756093 is a potent inhibitor of the GBP1:PIM1 interaction. NSC756093 can potentially revert resistance to paclitaxel. NSC756093 can be used for ovarian cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 561.8±50.0 °C at 760 mmHg |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.37 |
| Flash Point | 293.6±30.1 °C |
| Exact Mass | 337.131409 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | SMEJQLRLHKWIFV-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)N(CCO)C1=C(C(=O)OC1)C2c1ccccc1 |
| Storage condition | -20°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H400 |
| Precautionary Statements | P273-P301 + P312 + P330-P391 |
| RIDADR | UN 3077 9 / PGIII |
| Furo[3,4-b]quinolin-1(3H)-one, 4,9-dihydro-4-(2-hydroxyethyl)-6-methoxy-9-phenyl- |
| 4-(2-Hydroxyethyl)-6-methoxy-9-phenyl-4,9-dihydrofuro[3,4-b]quinolin-1(3H)-one |