9H-Fluoren-9-one,6-amino-2-fluoro- structure
|
Common Name | 9H-Fluoren-9-one,6-amino-2-fluoro- | ||
|---|---|---|---|---|
| CAS Number | 16234-85-8 | Molecular Weight | 213.20700 | |
| Density | 1.408g/cm3 | Boiling Point | 434.5ºC at 760mmHg | |
| Molecular Formula | C13H8FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.6ºC | |
| Name | 6-amino-2-fluorofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Boiling Point | 434.5ºC at 760mmHg |
| Molecular Formula | C13H8FNO |
| Molecular Weight | 213.20700 |
| Flash Point | 216.6ºC |
| Exact Mass | 213.05900 |
| PSA | 43.09000 |
| LogP | 3.20050 |
| Vapour Pressure | 9.45E-08mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | AYSCNZVRTTWOHG-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)-c1ccc(F)cc1C2=O |
|
~%
9H-Fluoren-9-on... CAS#:16234-85-8 |
| Literature: Fletcher,T.L. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 936 - 941 |
|
~%
9H-Fluoren-9-on... CAS#:16234-85-8 |
| Literature: Fletcher,T.L. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 936 - 941 |
| 6-amino-2-fluoro-9h-fluoren-9-one |
| 7-Fluor-3-amino-9-oxo-fluoren |