4-(tert-butoxy)benzotrifluoride
Modify Date: 2025-08-25 16:57:26
4-(tert-butoxy)benzotrifluoride structure
|
Common Name | 4-(tert-butoxy)benzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 16222-44-9 | Molecular Weight | 218.21600 | |
| Density | 1.11g/cm3 | Boiling Point | 218.2ºC at 760 mmHg | |
| Molecular Formula | C11H13F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.5ºC | |
| Name | 1-[(2-methylpropan-2-yl)oxy]-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 218.2ºC at 760 mmHg |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.21600 |
| Flash Point | 92.5ºC |
| Exact Mass | 218.09200 |
| PSA | 9.23000 |
| LogP | 3.88270 |
| Vapour Pressure | 0.188mmHg at 25°C |
| Index of Refraction | 1.439 |
| InChIKey | YXTJJRXJNYHJPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Oc1ccc(C(F)(F)F)cc1 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 22;36/37/38 |
| Safety Phrases | 26;36/37/38 |
| HS Code | 2909309090 |
|
~42%
4-(tert-butoxy)... CAS#:16222-44-9 |
| Literature: Artamkina; Sergeev; Shtern; Beletskaya Russian Journal of Organic Chemistry, 2006 , vol. 42, # 11 p. 1683 - 1689 |
|
~86%
4-(tert-butoxy)... CAS#:16222-44-9 |
| Literature: Watanabe, Makoto; Nishiyama, Masakazu; Koie, Yasuyuki Tetrahedron Letters, 1999 , vol. 40, # 50 p. 8837 - 8840 |
|
~10%
4-(tert-butoxy)... CAS#:16222-44-9 |
| Literature: AGENCY FOR SCIENCE, TECHNOLOGY AND RESEARCH Patent: WO2008/136770 A1, 2008 ; Location in patent: Page/Page column 24-25 ; |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| p-(trifluoromethyl)phenyl tert-butyl ether |
| PC5876 |
| 4-(tert-Butoxy)benzotrifluoride |
| para-trifluoromethylphenyl tert-butyl ether |
| 1-(tert-Butoxy)-4-(trifluoromethyl)benzene |
| tert-butyl 4-trifluoromethylphenyl ether |