1-[3,5-Bis(trifluoromethyl)phenyl]piperazine structure
|
Common Name | 1-[3,5-Bis(trifluoromethyl)phenyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 16172-96-6 | Molecular Weight | 298.228 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 301.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H12F6N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.9±27.9 °C | |
| Name | 1-[3,5-bis(trifluoromethyl)phenyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.1±42.0 °C at 760 mmHg |
| Molecular Formula | C12H12F6N2 |
| Molecular Weight | 298.228 |
| Flash Point | 135.9±27.9 °C |
| Exact Mass | 298.090454 |
| PSA | 15.27000 |
| LogP | 4.03 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.445 |
| InChIKey | KBJABLNQZCSKGE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(N2CCNCC2)cc(C(F)(F)F)c1 |
|
~65%
1-[3,5-Bis(trif... CAS#:16172-96-6 |
| Literature: Liu, Kevin G.; Robichaud, Albert J. Tetrahedron Letters, 2005 , vol. 46, # 46 p. 7921 - 7922 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD01476131 |
| N-(3,5-di-trifluoromethylphenyl)-piperazine |
| 1-[3,5-Bis(trifluoromethyl)phenyl]piperazine |
| N-(3,5-bistrifluorometylphenyl)piperazine |
| 1-(3,5-bistrifluoromethylphenyl)piperazine |
| Piperazine, 1-[3,5-bis(trifluoromethyl)phenyl]- |