2-Phenylmaleic acid structure
|
Common Name | 2-Phenylmaleic acid | ||
|---|---|---|---|---|
| CAS Number | 16110-98-8 | Molecular Weight | 192.16800 | |
| Density | 1.377g/cm3 | Boiling Point | 347.8ºC at 760mmHg | |
| Molecular Formula | C10H8O4 | Melting Point | 107-108ºC | |
| MSDS | N/A | Flash Point | 178.3ºC | |
| Name | 2-phenylbut-2-enedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 347.8ºC at 760mmHg |
| Melting Point | 107-108ºC |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.16800 |
| Flash Point | 178.3ºC |
| Exact Mass | 192.04200 |
| PSA | 74.60000 |
| LogP | 1.23920 |
| Vapour Pressure | 1.98E-05mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | CQNPSIAJXGEDQS-VURMDHGXSA-N |
| SMILES | O=C(O)C=C(C(=O)O)c1ccccc1 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-phenylmaleic acid |
| Phenylmaleinsaeure |
| Phenyl-cis-butendisaeure |
| PHENYLMALEIC ACID |
| 2-phenyl-2-butenedioic acid |