potassium,4-methylbenzenesulfonate structure
|
Common Name | potassium,4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 16106-44-8 | Molecular Weight | 210.29200 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H7KO3S | Melting Point | 106-107ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | potassium,4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Melting Point | 106-107ºC |
| Molecular Formula | C7H7KO3S |
| Molecular Weight | 210.29200 |
| Exact Mass | 209.97500 |
| PSA | 65.58000 |
| LogP | 1.97990 |
| InChIKey | GHKGUEZUGFJUEJ-UHFFFAOYSA-M |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.[K+] |
| HS Code | 2904100000 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| potassium tosylate |
| Potassium toluene-4-sulphonate |
| potassium salt of p-toluenesulfonic acid |
| potassium 4-methylbenzenesulfonate |
| EINECS 240-273-5 |
| Benzenesulfonic acid,4-methyl-,potassium salt |
| Potassium p-toluenesulfonate |
| POTASSIUM 4-TOLUENESULFONATE |
| potassium toluene-p-sulphonate |
| p-toluenesulphonic acid potassium salt |