Alkyne-PEG4-maleimide
Modify Date: 2025-08-27 19:43:56
Alkyne-PEG4-maleimide structure
|
Common Name | Alkyne-PEG4-maleimide | ||
|---|---|---|---|---|
| CAS Number | 1609651-90-2 | Molecular Weight | 382.408 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 575.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H26N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.1±30.1 °C | |
Use of Alkyne-PEG4-maleimideAlkyne-PEG4-maleimide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-N-(3,6,9,12-tetraoxapentadec-14-yn-1-yl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Alkyne-PEG4-maleimide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.8±50.0 °C at 760 mmHg |
| Molecular Formula | C18H26N2O7 |
| Molecular Weight | 382.408 |
| Flash Point | 302.1±30.1 °C |
| Exact Mass | 382.174011 |
| LogP | -1.51 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | GHEBECZRHJXPTL-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| 3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-N-(3,6,9,12-tetraoxapentadec-14-yn-1-yl)propanamide |
| 1H-Pyrrole-1-propanamide, 2,5-dihydro-2,5-dioxo-N-3,6,9,12-tetraoxapentadec-14-yn-1-yl- |
| Propargyl-PEG4-Maleimide |