[4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate
Modify Date: 2025-09-11 19:13:51
![[4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate Structure](https://image.chemsrc.com/caspic/071/16083-79-7.png)
[4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate structure
|
Common Name | [4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 16083-79-7 | Molecular Weight | 412.19600 | |
| Density | 1.456g/cm3 | Boiling Point | 271.8ºC at 760mmHg | |
| Molecular Formula | C12H11F11O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.2ºC | |
| Name | [4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 271.8ºC at 760mmHg |
| Molecular Formula | C12H11F11O3 |
| Molecular Weight | 412.19600 |
| Flash Point | 118.2ºC |
| Exact Mass | 412.05300 |
| PSA | 46.53000 |
| LogP | 3.96020 |
| Vapour Pressure | 0.000824mmHg at 25°C |
| Index of Refraction | n20/D 1.374(lit.) |
| InChIKey | LZKRGSPBGVICLV-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant;F: Flammable; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2916140000 |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| MFCD00236097 |
| pc6104d |