Elamipretide TFA structure
|
Common Name | Elamipretide TFA | ||
|---|---|---|---|---|
| CAS Number | 1606994-55-1 | Molecular Weight | 753.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H50F3N9O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Elamipretide TFAElamipretide TFA (MTP-131 TFA; RX-31 TFA; SS-31 TFA) is a cardiolipin peroxidase inhibitor and mitochondria-targeting peptide[1]. |
| Name | Elamipretide TFA |
|---|
| Description | Elamipretide TFA (MTP-131 TFA; RX-31 TFA; SS-31 TFA) is a cardiolipin peroxidase inhibitor and mitochondria-targeting peptide[1]. |
|---|---|
| Related Catalog | |
| Target |
Cardiolipin peroxidase[1] |
| References |
| Molecular Formula | C34H50F3N9O7 |
|---|---|
| Molecular Weight | 753.81 |
| InChIKey | WLZHRKGRZBGUJU-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc(C)c1CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(N)=O.O=C(O)C(F)(F)F |
| Storage condition | -20°C |