N4-Benzoyl-5'-O-DMT-5-methylcytidine structure
|
Common Name | N4-Benzoyl-5'-O-DMT-5-methylcytidine | ||
|---|---|---|---|---|
| CAS Number | 160107-17-5 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N4-Benzoyl-5'-O-DMT-5-methylcytidineN4-Benzoyl-5'-O-DMT-5-methylcytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. |
| Name | N4-Benzoyl-5‘-O-(4,4'-dimethoxytrityl)-5-methylcytidine |
|---|
| Description | N4-Benzoyl-5'-O-DMT-5-methylcytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. |
|---|---|
| Related Catalog | |
| References |
| InChIKey | QCKRNDPKDFQXCO-DHKUXYTCSA-N |
|---|---|
| SMILES | COc1ccc(C(OCC2OC(n3cc(C)c(NC(=O)c4ccccc4)nc3=O)C(O)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |