1,3,5,7-Cyclooctatetraene-1,2-dicarboxylicacid, 1,2-dimethyl ester structure
|
Common Name | 1,3,5,7-Cyclooctatetraene-1,2-dicarboxylicacid, 1,2-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 15956-91-9 | Molecular Weight | 220.22100 | |
| Density | 1.181g/cm3 | Boiling Point | 338.1ºC at 760mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5ºC | |
| Name | dimethyl (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 338.1ºC at 760mmHg |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Flash Point | 168.5ºC |
| Exact Mass | 220.07400 |
| PSA | 52.60000 |
| LogP | 1.31120 |
| Vapour Pressure | 0.0001mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | OLLLUZVYFNNOAS-LDQJSDFUSA-N |
| SMILES | COC(=O)C1=C(C(=O)OC)C=CC=CC=C1 |
|
~%
1,3,5,7-Cyclooc... CAS#:15956-91-9 |
| Literature: Grovenstein,E. et al. Journal of Organic Chemistry, 1969 , vol. 34, # 8 p. 2418 - 2428 |
|
~82%
Detail
|
| Literature: Bryce-Smith, D.; Gilbert, A.; Al-Jalal, N.; Deshpande, R.R.; Grzonka, J.; et al. Zeitschrift fuer Naturforschung, Teil B: Anorganische Chemie, Organische Chemie, 1983 , vol. 38, # 9 p. 1101 - 1112 |
| 1,2-dicarbomethoxycyclooctatetraene |
| dimethyl cyclooctatetraen-1,2-dicarboxylate |
| dimethyl cyclooctatetraene-1,2-dicarboxylate |
| Cyclooctatetraen-1.2-dicarbonsaeure-dimethylester |