(1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2-dicarboxylic acid
Modify Date: 2025-09-18 10:03:02
(1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2-dicarboxylic acid structure
|
Common Name | (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 13753-01-0 | Molecular Weight | 192.16800 | |
| Density | 1.417g/cm3 | Boiling Point | 382.6ºC at 760 mmHg | |
| Molecular Formula | C10H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.3ºC | |
| Name | (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760 mmHg |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.16800 |
| Flash Point | 199.3ºC |
| Exact Mass | 192.04200 |
| PSA | 74.60000 |
| LogP | 1.13440 |
| Vapour Pressure | 6.51E-07mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | OKRRQQUSUAYNOD-ZIQUEYDMSA-N |
| SMILES | O=C(O)C1=C(C(=O)O)C=CC=CC=C1 |
|
~%
(1Z,3Z,5Z,7Z)-c... CAS#:13753-01-0 |
| Literature: Cope,A.C.; Meili,J.E. Journal of the American Chemical Society, 1967 , vol. 89, # 8 p. 1883 - 1886 |
|
~%
(1Z,3Z,5Z,7Z)-c... CAS#:13753-01-0 |
| Literature: Bryce-Smith,D.; Lodge,J.E. Journal of the Chemical Society, 1963 , p. 695 - 701 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1.2-Dicarboxy-cyclooctatetraen |
| 2.4.6.8-Cyclooctatetraen-1.2-dicarbonsaeure |
| Cycloocta-2,4,6,8-tetraen-1,2-dicarbonsaeure |
| Cyclo-octatetraen-1,2-dicarbonsaeure |