4-[(Z)-2-(4-nitrophenyl)ethenyl]benzonitrile structure
|
Common Name | 4-[(Z)-2-(4-nitrophenyl)ethenyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 159394-73-7 | Molecular Weight | 250.25200 | |
| Density | 1.26g/cm3 | Boiling Point | 418.9ºC at 760 mmHg | |
| Molecular Formula | C15H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.1ºC | |
| Name | 4-[(Z)-2-(4-nitrophenyl)ethenyl]benzonitrile |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 418.9ºC at 760 mmHg |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.25200 |
| Flash Point | 207.1ºC |
| Exact Mass | 250.07400 |
| PSA | 69.61000 |
| LogP | 4.16008 |
| Vapour Pressure | 3.16E-07mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | AVUPZCWYUFGWKE-UPHRSURJSA-N |
| SMILES | N#Cc1ccc(C=Cc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
4-[(Z)-2-(4-nit... CAS#:159394-73-7 |
| Literature: Yang, Jye-Shane; Lin, Yan-Duo; Lin, Yu-Hsi; Liao, Fen-Ling Journal of Organic Chemistry, 2004 , vol. 69, # 10 p. 3517 - 3525 |
|
~35%
4-[(Z)-2-(4-nit... CAS#:159394-73-7 |
| Literature: Hooberman; Brezzell; Das; You; Sinsheimer Mutation Research - Genetic Toxicology, 1994 , vol. 341, # 1 p. 57 - 69 |